C27H33N3O2 — CID 122175074
N-(1-benzylpiperidin-4-yl)-2-cyclohexyl-3-oxo-1H-isoindole-4-carboxamide (PubChem CID 122175074) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-cyclohexyl-3-oxo-1H-isoindole-4-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-cyclohexyl-3-oxo-1H-isoindole-4-carboxamide |
|---|---|
| PubChem CID | 122175074 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-cyclohexyl-3-oxo-1H-isoindole-4-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1cccc2c1C(=O)N(C1CCCCC1)C2 |
| InChI | InChI=1S/C27H33N3O2/c31-26(28-22-14-16-29(17-15-22)18-20-8-3-1-4-9-20)24-13-7-10-21-19-30(27(32)25(21)24)23-11-5-2-6-12-23/h1,3-4,7-10,13,22-23H,2,5-6,11-12,14-19H2,(H,28,31) |
| InChIKey | MERNLZKESRESGX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |