C26H24N4O3 — CID 122175178
2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-phenylquinazolin-4-one (PubChem CID 122175178) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-phenylquinazolin-4-one.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 122175178 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-phenylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)n1-c1ccccc1 |
| InChI | InChI=1S/C26H24N4O3/c31-25-21-8-4-5-9-22(21)27-26(30(25)20-6-2-1-3-7-20)29-14-12-28(13-15-29)17-19-10-11-23-24(16-19)33-18-32-23/h1-11,16H,12-15,17-18H2 |
| InChIKey | QBCLKMFULAPDLE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |