C20H28N2O2S — CID 122176139
N-cyclohexyl-2-(2,2-dimethyl-4-oxo-3H-1,5-benzothiazepin-5-yl)propanamide (PubChem CID 122176139) has the molecular formula C20H28N2O2S and a molecular weight of 360.52 g/mol. Its IUPAC name is N-cyclohexyl-2-(2,2-dimethyl-4-oxo-3H-1,5-benzothiazepin-5-yl)propanamide.
| Compound Name | N-cyclohexyl-2-(2,2-dimethyl-4-oxo-3H-1,5-benzothiazepin-5-yl)propanamide |
|---|---|
| PubChem CID | 122176139 |
| Molecular Formula | C20H28N2O2S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | N-cyclohexyl-2-(2,2-dimethyl-4-oxo-3H-1,5-benzothiazepin-5-yl)propanamide |
| SMILES | CC(C(=O)NC1CCCCC1)N1C(=O)CC(C)(C)Sc2ccccc21 |
| InChI | InChI=1S/C20H28N2O2S/c1-14(19(24)21-15-9-5-4-6-10-15)22-16-11-7-8-12-17(16)25-20(2,3)13-18(22)23/h7-8,11-12,14-15H,4-6,9-10,13H2,1-3H3,(H,21,24) |
| InChIKey | NFLTZNPWHILRNC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |