C31H28N4O7S — CID 122177383
methyl 2-[[(2S)-3-(1H-indol-3-yl)-2-[[2-[1-(4-methylphenyl)sulfonylindol-3-yl]-2-oxoacetyl]amino]propanoyl]amino]acetate (PubChem CID 122177383) has the molecular formula C31H28N4O7S and a molecular weight of 600.65 g/mol. Its IUPAC name is methyl 2-[[(2S)-3-(1H-indol-3-yl)-2-[[2-[1-(4-methylphenyl)sulfonylindol-3-yl]-2-oxoacetyl]amino]propanoyl]amino]acetate.
| Compound Name | methyl 2-[[(2S)-3-(1H-indol-3-yl)-2-[[2-[1-(4-methylphenyl)sulfonylindol-3-yl]-2-oxoacetyl]amino]propanoyl]amino]acetate |
|---|---|
| PubChem CID | 122177383 |
| Molecular Formula | C31H28N4O7S |
| Molecular Weight | 600.65 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | methyl 2-[[(2S)-3-(1H-indol-3-yl)-2-[[2-[1-(4-methylphenyl)sulfonylindol-3-yl]-2-oxoacetyl]amino]propanoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)C(=O)c1cn(S(=O)(=O)c2ccc(C)cc2)c2ccccc12 |
| InChI | InChI=1S/C31H28N4O7S/c1-19-11-13-21(14-12-19)43(40,41)35-18-24(23-8-4-6-10-27(23)35)29(37)31(39)34-26(30(38)33-17-28(36)42-2)15-20-16-32-25-9-5-3-7-22(20)25/h3-14,16,18,26,32H,15,17H2,1-2H3,(H,33,38)(H,34,39)/t26-/m0/s1 |
| InChIKey | IXGKBHNNKBZUSL-SANMLTNESA-N |
| XLogP | 2.87 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.65 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|