C17H22N2O5 — CID 122177418
methyl (2S)-2-[[2-(2-acetamidophenyl)-2-oxoacetyl]amino]-4-methylpentanoate (PubChem CID 122177418) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(2-acetamidophenyl)-2-oxoacetyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[2-(2-acetamidophenyl)-2-oxoacetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 122177418 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | methyl (2S)-2-[[2-(2-acetamidophenyl)-2-oxoacetyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)C(=O)c1ccccc1NC(C)=O |
| InChI | InChI=1S/C17H22N2O5/c1-10(2)9-14(17(23)24-4)19-16(22)15(21)12-7-5-6-8-13(12)18-11(3)20/h5-8,10,14H,9H2,1-4H3,(H,18,20)(H,19,22)/t14-/m0/s1 |
| InChIKey | AQXUUUJZLZKMQT-AWEZNQCLSA-N |
| XLogP | 1.53 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|