C20H20N4O3 — CID 122179719
2-methyl-N-(2-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidin-9-yl)benzamide (PubChem CID 122179719) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-methyl-N-(2-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidin-9-yl)benzamide.
| Compound Name | 2-methyl-N-(2-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidin-9-yl)benzamide |
|---|---|
| PubChem CID | 122179719 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-methyl-N-(2-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidin-9-yl)benzamide |
| SMILES | Cc1ccccc1C(=O)Nc1cccn2c(=O)cc(N3CCOCC3)nc12 |
| InChI | InChI=1S/C20H20N4O3/c1-14-5-2-3-6-15(14)20(26)21-16-7-4-8-24-18(25)13-17(22-19(16)24)23-9-11-27-12-10-23/h2-8,13H,9-12H2,1H3,(H,21,26) |
| InChIKey | LXOSWIBILOAULT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |