C18H14F3N5O3S — CID 122180353
N-[2-[4-oxo-5-(2,2,2-trifluoroethyl)-1H-pyrazolo[4,5-c][1,5]naphthyridin-7-yl]phenyl]methanesulfonamide (PubChem CID 122180353) has the molecular formula C18H14F3N5O3S and a molecular weight of 437.40 g/mol. Its IUPAC name is N-[2-[4-oxo-5-(2,2,2-trifluoroethyl)-1H-pyrazolo[4,5-c][1,5]naphthyridin-7-yl]phenyl]methanesulfonamide.
| Compound Name | N-[2-[4-oxo-5-(2,2,2-trifluoroethyl)-1H-pyrazolo[4,5-c][1,5]naphthyridin-7-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 122180353 |
| Molecular Formula | C18H14F3N5O3S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | N-[2-[4-oxo-5-(2,2,2-trifluoroethyl)-1H-pyrazolo[4,5-c][1,5]naphthyridin-7-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1-c1cnc2c3[nH]ncc3c(=O)n(CC(F)(F)F)c2c1 |
| InChI | InChI=1S/C18H14F3N5O3S/c1-30(28,29)25-13-5-3-2-4-11(13)10-6-14-16(22-7-10)15-12(8-23-24-15)17(27)26(14)9-18(19,20)21/h2-8,25H,9H2,1H3,(H,23,24) |
| InChIKey | IGFGLGIEYSBFJP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|