C27H29N3 — CID 122180810
6-[2-[(2R,6S)-6-(2-quinolin-6-ylethyl)piperidin-2-yl]ethyl]quinoline (PubChem CID 122180810) has the molecular formula C27H29N3 and a molecular weight of 395.55 g/mol. Its IUPAC name is 6-[2-[(2R,6S)-6-(2-quinolin-6-ylethyl)piperidin-2-yl]ethyl]quinoline.
| Compound Name | 6-[2-[(2R,6S)-6-(2-quinolin-6-ylethyl)piperidin-2-yl]ethyl]quinoline |
|---|---|
| PubChem CID | 122180810 |
| Molecular Formula | C27H29N3 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 6-[2-[(2R,6S)-6-(2-quinolin-6-ylethyl)piperidin-2-yl]ethyl]quinoline |
| SMILES | c1cnc2ccc(CC[C@H]3CCC[C@@H](CCc4ccc5ncccc5c4)N3)cc2c1 |
| InChI | InChI=1S/C27H29N3/c1-6-24(12-8-20-10-14-26-22(18-20)4-2-16-28-26)30-25(7-1)13-9-21-11-15-27-23(19-21)5-3-17-29-27/h2-5,10-11,14-19,24-25,30H,1,6-9,12-13H2/t24-,25+ |
| InChIKey | XSYQEDYFLKAECZ-PLQXJYEYSA-N |
| XLogP | 5.86 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |