C19H20N2O — CID 122181274
1-[4-[(Z)-2-(3,5-dimethylphenyl)ethenyl]phenyl]imidazolidin-2-one (PubChem CID 122181274) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-[4-[(Z)-2-(3,5-dimethylphenyl)ethenyl]phenyl]imidazolidin-2-one.
| Compound Name | 1-[4-[(Z)-2-(3,5-dimethylphenyl)ethenyl]phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 122181274 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1-[4-[(Z)-2-(3,5-dimethylphenyl)ethenyl]phenyl]imidazolidin-2-one |
| SMILES | Cc1cc(C)cc(/C=C\c2ccc(N3CCNC3=O)cc2)c1 |
| InChI | InChI=1S/C19H20N2O/c1-14-11-15(2)13-17(12-14)4-3-16-5-7-18(8-6-16)21-10-9-20-19(21)22/h3-8,11-13H,9-10H2,1-2H3,(H,20,22)/b4-3- |
| InChIKey | ZRLZIEPYMVKULB-ARJAWSKDSA-N |
| XLogP | 4.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|