C18H20N6O2 — CID 122182022
3-[(3R,4R)-4-methyl-3-(5-methyl-4-oxo-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-3-yl)piperidin-1-yl]-3-oxopropanenitrile (PubChem CID 122182022) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 3-[(3R,4R)-4-methyl-3-(5-methyl-4-oxo-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-3-yl)piperidin-1-yl]-3-oxopropanenitrile.
| Compound Name | 3-[(3R,4R)-4-methyl-3-(5-methyl-4-oxo-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-3-yl)piperidin-1-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 122182022 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 3-[(3R,4R)-4-methyl-3-(5-methyl-4-oxo-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-3-yl)piperidin-1-yl]-3-oxopropanenitrile |
| SMILES | C[C@@H]1CCN(C(=O)CC#N)C[C@@H]1n1c(=O)n(C)c2cnc3[nH]ccc3c21 |
| InChI | InChI=1S/C18H20N6O2/c1-11-5-8-23(15(25)3-6-19)10-14(11)24-16-12-4-7-20-17(12)21-9-13(16)22(2)18(24)26/h4,7,9,11,14H,3,5,8,10H2,1-2H3,(H,20,21)/t11-,14+/m1/s1 |
| InChIKey | PKPWJJSXCPIAQF-RISCZKNCSA-N |
| XLogP | 1.54 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |