C20H25NO — CID 122182722
2-[(4-cyclohexylanilino)methyl]-6-methylphenol (PubChem CID 122182722) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[(4-cyclohexylanilino)methyl]-6-methylphenol.
| Compound Name | 2-[(4-cyclohexylanilino)methyl]-6-methylphenol |
|---|---|
| PubChem CID | 122182722 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-[(4-cyclohexylanilino)methyl]-6-methylphenol |
| SMILES | Cc1cccc(CNc2ccc(C3CCCCC3)cc2)c1O |
| InChI | InChI=1S/C20H25NO/c1-15-6-5-9-18(20(15)22)14-21-19-12-10-17(11-13-19)16-7-3-2-4-8-16/h5-6,9-13,16,21-22H,2-4,7-8,14H2,1H3 |
| InChIKey | NDIWSSSCLAIIAI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|