C16H15N3O2 — CID 115903751
2-methyl-6-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]phenol (PubChem CID 115903751) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-methyl-6-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]phenol.
| Compound Name | 2-methyl-6-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]phenol |
|---|---|
| PubChem CID | 115903751 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-methyl-6-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]phenol |
| SMILES | Cc1cccc(CNc2ccc(-c3nnco3)cc2)c1O |
| InChI | InChI=1S/C16H15N3O2/c1-11-3-2-4-13(15(11)20)9-17-14-7-5-12(6-8-14)16-19-18-10-21-16/h2-8,10,17,20H,9H2,1H3 |
| InChIKey | RAMNKYKKLXHLSL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|