About 4-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]benzonitrile
4-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]benzonitrile (PubChem CID 28713347) has the molecular formula C16H12N4O
and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]benzonitrile |
| PubChem CID | 28713347 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNc2ccc(-c3nnco3)cc2)cc1 |
| InChI | InChI=1S/C16H12N4O/c17-9-12-1-3-13(4-2-12)10-18-15-7-5-14(6-8-15)16-20-19-11-21-16/h1-8,11,18H,10H2 |
| InChIKey | RCCATYYBWQEHKY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]benzonitrile?
The IUPAC name of 4-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]benzonitrile (CID 28713347) is 4-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]benzonitrile.
What is the SMILES notation for 4-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]benzonitrile?
The canonical SMILES for 4-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]benzonitrile is N#Cc1ccc(CNc2ccc(-c3nnco3)cc2)cc1.
What is the InChIKey of 4-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]benzonitrile?
The InChIKey is RCCATYYBWQEHKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4O/c17-9-12-1-3-13(4-2-12)10-18-15-7-5-14(6-8-15)16-20-19-11-21-16/h1-8,11,18H,10H2.
What are the key properties of 4-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]benzonitrile?
4-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]benzonitrile has a molecular weight of 276.30 g/mol, XLogP of 3.22, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]benzonitrile is sourced from PubChem (CID 28713347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).