C13H12N4OS — CID 66387317
2-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]thiophen-3-amine (PubChem CID 66387317) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]thiophen-3-amine.
| Compound Name | 2-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66387317 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]thiophen-3-amine |
| SMILES | Nc1ccsc1CNc1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C13H12N4OS/c14-11-5-6-19-12(11)7-15-10-3-1-9(2-4-10)13-17-16-8-18-13/h1-6,8,15H,7,14H2 |
| InChIKey | WBEGTRZLCJSVAW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |