C15H12ClN3O2 — CID 29031159
4-chloro-2-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]phenol (PubChem CID 29031159) has the molecular formula C15H12ClN3O2 and a molecular weight of 301.73 g/mol. Its IUPAC name is 4-chloro-2-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]phenol.
| Compound Name | 4-chloro-2-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]phenol |
|---|---|
| PubChem CID | 29031159 |
| Molecular Formula | C15H12ClN3O2 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 4-chloro-2-[[4-(1,3,4-oxadiazol-2-yl)anilino]methyl]phenol |
| SMILES | Oc1ccc(Cl)cc1CNc1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C15H12ClN3O2/c16-12-3-6-14(20)11(7-12)8-17-13-4-1-10(2-5-13)15-19-18-9-21-15/h1-7,9,17,20H,8H2 |
| InChIKey | SUFAYYISROTQJU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|