C13H17N3OS — CID 103087303
N-(4-methylsulfanylbutyl)-4-(1,3,4-oxadiazol-2-yl)aniline (PubChem CID 103087303) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is N-(4-methylsulfanylbutyl)-4-(1,3,4-oxadiazol-2-yl)aniline.
| Compound Name | N-(4-methylsulfanylbutyl)-4-(1,3,4-oxadiazol-2-yl)aniline |
|---|---|
| PubChem CID | 103087303 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-(4-methylsulfanylbutyl)-4-(1,3,4-oxadiazol-2-yl)aniline |
| SMILES | CSCCCCNc1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C13H17N3OS/c1-18-9-3-2-8-14-12-6-4-11(5-7-12)13-16-15-10-17-13/h4-7,10,14H,2-3,8-9H2,1H3 |
| InChIKey | QIMXULQHXVDEAP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|