C19H21ClN6O3 — CID 122182849
3-[4-(diaminomethylideneamino)phenyl]-N-(2,4-dimethoxyphenyl)-1H-pyrazole-5-carboxamide;hydrochloride (PubChem CID 122182849) has the molecular formula C19H21ClN6O3 and a molecular weight of 416.87 g/mol. Its IUPAC name is 3-[4-(diaminomethylideneamino)phenyl]-N-(2,4-dimethoxyphenyl)-1H-pyrazole-5-carboxamide;hydrochloride.
| Compound Name | 3-[4-(diaminomethylideneamino)phenyl]-N-(2,4-dimethoxyphenyl)-1H-pyrazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 122182849 |
| Molecular Formula | C19H21ClN6O3 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 3-[4-(diaminomethylideneamino)phenyl]-N-(2,4-dimethoxyphenyl)-1H-pyrazole-5-carboxamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)c2cc(-c3ccc(N=C(N)N)cc3)n[nH]2)c(OC)c1.Cl |
| InChI | InChI=1S/C19H20N6O3.ClH/c1-27-13-7-8-14(17(9-13)28-2)23-18(26)16-10-15(24-25-16)11-3-5-12(6-4-11)22-19(20)21;/h3-10H,1-2H3,(H,23,26)(H,24,25)(H4,20,21,22);1H |
| InChIKey | MTVBKSBKALSPDR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|