C19H21ClN6O — CID 122182863
3-[4-(diaminomethylideneamino)phenyl]-N-(2,5-dimethylphenyl)-1H-pyrazole-5-carboxamide;hydrochloride (PubChem CID 122182863) has the molecular formula C19H21ClN6O and a molecular weight of 384.87 g/mol. Its IUPAC name is 3-[4-(diaminomethylideneamino)phenyl]-N-(2,5-dimethylphenyl)-1H-pyrazole-5-carboxamide;hydrochloride.
| Compound Name | 3-[4-(diaminomethylideneamino)phenyl]-N-(2,5-dimethylphenyl)-1H-pyrazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 122182863 |
| Molecular Formula | C19H21ClN6O |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 3-[4-(diaminomethylideneamino)phenyl]-N-(2,5-dimethylphenyl)-1H-pyrazole-5-carboxamide;hydrochloride |
| SMILES | Cc1ccc(C)c(NC(=O)c2cc(-c3ccc(N=C(N)N)cc3)n[nH]2)c1.Cl |
| InChI | InChI=1S/C19H20N6O.ClH/c1-11-3-4-12(2)15(9-11)23-18(26)17-10-16(24-25-17)13-5-7-14(8-6-13)22-19(20)21;/h3-10H,1-2H3,(H,23,26)(H,24,25)(H4,20,21,22);1H |
| InChIKey | JLOJYEOLPJYLIB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 122.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|