C17H13BrFN3O — CID 45030513
N-(2-bromo-4-methylphenyl)-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 45030513) has the molecular formula C17H13BrFN3O and a molecular weight of 374.21 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 45030513 |
| Molecular Formula | C17H13BrFN3O |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(-c3ccc(F)cc3)n[nH]2)c(Br)c1 |
| InChI | InChI=1S/C17H13BrFN3O/c1-10-2-7-14(13(18)8-10)20-17(23)16-9-15(21-22-16)11-3-5-12(19)6-4-11/h2-9H,1H3,(H,20,23)(H,21,22) |
| InChIKey | WMGLIERKAFTZPC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |