C25H22N4O4 — CID 122183645
4-[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-N-[(E)-(4-methylphenyl)methylideneamino]benzamide (PubChem CID 122183645) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is 4-[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-N-[(E)-(4-methylphenyl)methylideneamino]benzamide.
| Compound Name | 4-[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-N-[(E)-(4-methylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 122183645 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 4-[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-N-[(E)-(4-methylphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(-c2nnc(-c3ccc(C(=O)N/N=C/c4ccc(C)cc4)cc3)o2)c(OC)c1 |
| InChI | InChI=1S/C25H22N4O4/c1-16-4-6-17(7-5-16)15-26-27-23(30)18-8-10-19(11-9-18)24-28-29-25(33-24)21-13-12-20(31-2)14-22(21)32-3/h4-15H,1-3H3,(H,27,30)/b26-15+ |
| InChIKey | HODGHMGRUBAHHP-CVKSISIWSA-N |
| XLogP | 4.49 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|