C17H14N4S — CID 122184536
6-(1-benzylpyrazol-4-yl)-1,3-benzothiazol-2-amine (PubChem CID 122184536) has the molecular formula C17H14N4S and a molecular weight of 306.39 g/mol. Its IUPAC name is 6-(1-benzylpyrazol-4-yl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-(1-benzylpyrazol-4-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 122184536 |
| Molecular Formula | C17H14N4S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 6-(1-benzylpyrazol-4-yl)-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2ccc(-c3cnn(Cc4ccccc4)c3)cc2s1 |
| InChI | InChI=1S/C17H14N4S/c18-17-20-15-7-6-13(8-16(15)22-17)14-9-19-21(11-14)10-12-4-2-1-3-5-12/h1-9,11H,10H2,(H2,18,20) |
| InChIKey | BYTQGWNNPKNUGP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |