C14H12N4O2S — CID 87562851
[5-(2-amino-1,3-benzothiazol-6-yl)-3-pyridinyl]methylcarbamic acid (PubChem CID 87562851) has the molecular formula C14H12N4O2S and a molecular weight of 300.34 g/mol. Its IUPAC name is [5-(2-amino-1,3-benzothiazol-6-yl)-3-pyridinyl]methylcarbamic acid.
| Compound Name | [5-(2-amino-1,3-benzothiazol-6-yl)-3-pyridinyl]methylcarbamic acid |
|---|---|
| PubChem CID | 87562851 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | [5-(2-amino-1,3-benzothiazol-6-yl)-3-pyridinyl]methylcarbamic acid |
| SMILES | Nc1nc2ccc(-c3cncc(CNC(=O)O)c3)cc2s1 |
| InChI | InChI=1S/C14H12N4O2S/c15-13-18-11-2-1-9(4-12(11)21-13)10-3-8(5-16-7-10)6-17-14(19)20/h1-5,7,17H,6H2,(H2,15,18)(H,19,20) |
| InChIKey | ZVQAMASODXSLDI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |