C22H18N2O2S — CID 143886131
N-benzyl-2-oxo-2-(6-phenyl-1,3-benzothiazol-2-yl)acetamide;molecular hydrogen (PubChem CID 143886131) has the molecular formula C22H18N2O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is N-benzyl-2-oxo-2-(6-phenyl-1,3-benzothiazol-2-yl)acetamide;molecular hydrogen.
| Compound Name | N-benzyl-2-oxo-2-(6-phenyl-1,3-benzothiazol-2-yl)acetamide;molecular hydrogen |
|---|---|
| PubChem CID | 143886131 |
| Molecular Formula | C22H18N2O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-benzyl-2-oxo-2-(6-phenyl-1,3-benzothiazol-2-yl)acetamide;molecular hydrogen |
| SMILES | O=C(NCc1ccccc1)C(=O)c1nc2ccc(-c3ccccc3)cc2s1.[H][H] |
| InChI | InChI=1S/C22H16N2O2S.H2/c25-20(21(26)23-14-15-7-3-1-4-8-15)22-24-18-12-11-17(13-19(18)27-22)16-9-5-2-6-10-16;/h1-13H,14H2,(H,23,26);1H |
| InChIKey | ROXFDVTYVHQLAT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|