C17H11F3N2O2S — CID 143886097
2-(1,3-benzothiazol-2-yl)-2-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 143886097) has the molecular formula C17H11F3N2O2S and a molecular weight of 364.35 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-2-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-2-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 143886097 |
| Molecular Formula | C17H11F3N2O2S |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-2-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H11F3N2O2S/c18-17(19,20)11-7-5-10(6-8-11)9-21-15(24)14(23)16-22-12-3-1-2-4-13(12)25-16/h1-8H,9H2,(H,21,24) |
| InChIKey | BPORFRZQYDVCBN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|