C17H11BrF3NOS — CID 56599940
3-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]-1-benzothiophene-2-carboxamide (PubChem CID 56599940) has the molecular formula C17H11BrF3NOS and a molecular weight of 414.25 g/mol. Its IUPAC name is 3-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 56599940 |
| Molecular Formula | C17H11BrF3NOS |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 412.97 |
| IUPAC Name | 3-bromo-N-[[4-(trifluoromethyl)phenyl]methyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)c1sc2ccccc2c1Br |
| InChI | InChI=1S/C17H11BrF3NOS/c18-14-12-3-1-2-4-13(12)24-15(14)16(23)22-9-10-5-7-11(8-6-10)17(19,20)21/h1-8H,9H2,(H,22,23) |
| InChIKey | QMNLQMQAIORGPC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |