C22H13F3N4S2 — CID 21238201
N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline (PubChem CID 21238201) has the molecular formula C22H13F3N4S2 and a molecular weight of 454.50 g/mol. Its IUPAC name is N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline.
| Compound Name | N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 21238201 |
| Molecular Formula | C22H13F3N4S2 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1ccc(NN=C(c2nc3ccccc3s2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C22H13F3N4S2/c23-22(24,25)13-9-11-14(12-10-13)28-29-19(20-26-15-5-1-3-7-17(15)30-20)21-27-16-6-2-4-8-18(16)31-21/h1-12,28H |
| InChIKey | LNVTZYAYJGMFLR-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|