About N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline
N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline (PubChem CID 21238201) has the molecular formula C22H13F3N4S2
and a molecular weight of 454.50 g/mol. Its IUPAC name is N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline |
| PubChem CID | 21238201 |
| Molecular Formula | C22H13F3N4S2 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1ccc(NN=C(c2nc3ccccc3s2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C22H13F3N4S2/c23-22(24,25)13-9-11-14(12-10-13)28-29-19(20-26-15-5-1-3-7-17(15)30-20)21-27-16-6-2-4-8-18(16)31-21/h1-12,28H |
| InChIKey | LNVTZYAYJGMFLR-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline?
The IUPAC name of N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline (CID 21238201) is N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline.
What is the SMILES notation for N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline?
The canonical SMILES for N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline is FC(F)(F)c1ccc(NN=C(c2nc3ccccc3s2)c2nc3ccccc3s2)cc1.
What is the InChIKey of N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline?
The InChIKey is LNVTZYAYJGMFLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13F3N4S2/c23-22(24,25)13-9-11-14(12-10-13)28-29-19(20-26-15-5-1-3-7-17(15)30-20)21-27-16-6-2-4-8-18(16)31-21/h1-12,28H.
What are the key properties of N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline?
N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline has a molecular weight of 454.50 g/mol, XLogP of 6.79, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[bis(1,3-benzothiazol-2-yl)methylideneamino]-4-(trifluoromethyl)aniline is sourced from PubChem (CID 21238201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).