About [3-(4,5-diamino-3-pyridinyl)phenyl]methylcarbamic acid
[3-(4,5-diamino-3-pyridinyl)phenyl]methylcarbamic acid (PubChem CID 155070178) has the molecular formula C13H14N4O2
and a molecular weight of 258.28 g/mol. Its IUPAC name is [3-(4,5-diamino-3-pyridinyl)phenyl]methylcarbamic acid.
Molecular Properties
| Compound Name | [3-(4,5-diamino-3-pyridinyl)phenyl]methylcarbamic acid |
| PubChem CID | 155070178 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | [3-(4,5-diamino-3-pyridinyl)phenyl]methylcarbamic acid |
| SMILES | Nc1cncc(-c2cccc(CNC(=O)O)c2)c1N |
| InChI | InChI=1S/C13H14N4O2/c14-11-7-16-6-10(12(11)15)9-3-1-2-8(4-9)5-17-13(18)19/h1-4,6-7,17H,5,14H2,(H2,15,16)(H,18,19) |
| InChIKey | CEBKCNTWEVWFEG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(4,5-diamino-3-pyridinyl)phenyl]methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4,5-diamino-3-pyridinyl)phenyl]methylcarbamic acid?
The IUPAC name of [3-(4,5-diamino-3-pyridinyl)phenyl]methylcarbamic acid (CID 155070178) is [3-(4,5-diamino-3-pyridinyl)phenyl]methylcarbamic acid.
What is the SMILES notation for [3-(4,5-diamino-3-pyridinyl)phenyl]methylcarbamic acid?
The canonical SMILES for [3-(4,5-diamino-3-pyridinyl)phenyl]methylcarbamic acid is Nc1cncc(-c2cccc(CNC(=O)O)c2)c1N.
What is the InChIKey of [3-(4,5-diamino-3-pyridinyl)phenyl]methylcarbamic acid?
The InChIKey is CEBKCNTWEVWFEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O2/c14-11-7-16-6-10(12(11)15)9-3-1-2-8(4-9)5-17-13(18)19/h1-4,6-7,17H,5,14H2,(H2,15,16)(H,18,19).
What are the key properties of [3-(4,5-diamino-3-pyridinyl)phenyl]methylcarbamic acid?
[3-(4,5-diamino-3-pyridinyl)phenyl]methylcarbamic acid has a molecular weight of 258.28 g/mol, XLogP of 1.68, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4,5-diamino-3-pyridinyl)phenyl]methylcarbamic acid is sourced from PubChem (CID 155070178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).