C15H11ClN2O3 — CID 174224767
[3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]methylcarbamic acid (PubChem CID 174224767) has the molecular formula C15H11ClN2O3 and a molecular weight of 302.72 g/mol. Its IUPAC name is [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]methylcarbamic acid.
| Compound Name | [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 174224767 |
| Molecular Formula | C15H11ClN2O3 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]methylcarbamic acid |
| SMILES | O=C(O)NCc1cccc(-c2coc3cc(Cl)cnc23)c1 |
| InChI | InChI=1S/C15H11ClN2O3/c16-11-5-13-14(17-7-11)12(8-21-13)10-3-1-2-9(4-10)6-18-15(19)20/h1-5,7-8,18H,6H2,(H,19,20) |
| InChIKey | SJEQECBGQPSZIC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |