C14H10ClN3O2 — CID 171471574
[3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea (PubChem CID 171471574) has the molecular formula C14H10ClN3O2 and a molecular weight of 287.71 g/mol. Its IUPAC name is [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea.
| Compound Name | [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 171471574 |
| Molecular Formula | C14H10ClN3O2 |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea |
| SMILES | NC(=O)Nc1cccc(-c2coc3cc(Cl)cnc23)c1 |
| InChI | InChI=1S/C14H10ClN3O2/c15-9-5-12-13(17-6-9)11(7-20-12)8-2-1-3-10(4-8)18-14(16)19/h1-7H,(H3,16,18,19) |
| InChIKey | DJPGFRJQQOSOIE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |