About [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea
[3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea (PubChem CID 171471574) has the molecular formula C14H10ClN3O2
and a molecular weight of 287.71 g/mol. Its IUPAC name is [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea.
Molecular Properties
| Compound Name | [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea |
| PubChem CID | 171471574 |
| Molecular Formula | C14H10ClN3O2 |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea |
| SMILES | NC(=O)Nc1cccc(-c2coc3cc(Cl)cnc23)c1 |
| InChI | InChI=1S/C14H10ClN3O2/c15-9-5-12-13(17-6-9)11(7-20-12)8-2-1-3-10(4-8)18-14(16)19/h1-7H,(H3,16,18,19) |
| InChIKey | DJPGFRJQQOSOIE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea?
The IUPAC name of [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea (CID 171471574) is [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea.
What is the SMILES notation for [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea?
The canonical SMILES for [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea is NC(=O)Nc1cccc(-c2coc3cc(Cl)cnc23)c1.
What is the InChIKey of [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea?
The InChIKey is DJPGFRJQQOSOIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClN3O2/c15-9-5-12-13(17-6-9)11(7-20-12)8-2-1-3-10(4-8)18-14(16)19/h1-7H,(H3,16,18,19).
What are the key properties of [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea?
[3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea has a molecular weight of 287.71 g/mol, XLogP of 3.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(6-chlorofuro[3,2-b]pyridin-3-yl)phenyl]urea is sourced from PubChem (CID 171471574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).