C22H33N3O3 — CID 122185497
3-ethyl-8-[(2-hydroxy-5-methylphenyl)methyl]-1-(3-methylbutyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 122185497) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is 3-ethyl-8-[(2-hydroxy-5-methylphenyl)methyl]-1-(3-methylbutyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-ethyl-8-[(2-hydroxy-5-methylphenyl)methyl]-1-(3-methylbutyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 122185497 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 3-ethyl-8-[(2-hydroxy-5-methylphenyl)methyl]-1-(3-methylbutyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCN1C(=O)N(CCC(C)C)C2(CCN(Cc3cc(C)ccc3O)CC2)C1=O |
| InChI | InChI=1S/C22H33N3O3/c1-5-24-20(27)22(25(21(24)28)11-8-16(2)3)9-12-23(13-10-22)15-18-14-17(4)6-7-19(18)26/h6-7,14,16,26H,5,8-13,15H2,1-4H3 |
| InChIKey | KRNIRZRFHWBFQT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|