C37H43N3O4 — CID 122185604
(1S,12S,14R)-4-[6-[4-[(1H-indol-5-ylamino)methyl]phenoxy]hexyl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol (PubChem CID 122185604) has the molecular formula C37H43N3O4 and a molecular weight of 593.77 g/mol. Its IUPAC name is (1S,12S,14R)-4-[6-[4-[(1H-indol-5-ylamino)methyl]phenoxy]hexyl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol.
| Compound Name | (1S,12S,14R)-4-[6-[4-[(1H-indol-5-ylamino)methyl]phenoxy]hexyl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
|---|---|
| PubChem CID | 122185604 |
| Molecular Formula | C37H43N3O4 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.33 |
| IUPAC Name | (1S,12S,14R)-4-[6-[4-[(1H-indol-5-ylamino)methyl]phenoxy]hexyl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](O)C=C[C@@]31CCN(CCCCCCOc1ccc(CNc3ccc4[nH]ccc4c3)cc1)C2 |
| InChI | InChI=1S/C37H43N3O4/c1-42-33-13-8-28-25-40(20-17-37-16-14-30(41)23-34(37)44-36(33)35(28)37)19-4-2-3-5-21-43-31-10-6-26(7-11-31)24-39-29-9-12-32-27(22-29)15-18-38-32/h6-16,18,22,30,34,38-39,41H,2-5,17,19-21,23-25H2,1H3/t30-,34-,37-/m0/s1 |
| InChIKey | UZLRAURTWLGLEO-NUVMXGFHSA-N |
| XLogP | 6.95 |
| TPSA | 78.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|