C28H32N2O6S — CID 71210927
2-[5-[(12R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]pentyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 71210927) has the molecular formula C28H32N2O6S and a molecular weight of 524.64 g/mol. Its IUPAC name is 2-[5-[(12R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]pentyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[5-[(12R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]pentyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 71210927 |
| Molecular Formula | C28H32N2O6S |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 2-[5-[(12R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]pentyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | COc1ccc2c3c1O[C@@H]1CC(O)C=CC31CCN(CCCCCN1C(=O)c3ccccc3S1(=O)=O)C2 |
| InChI | InChI=1S/C28H32N2O6S/c1-35-22-10-9-19-18-29(16-13-28-12-11-20(31)17-24(28)36-26(22)25(19)28)14-5-2-6-15-30-27(32)21-7-3-4-8-23(21)37(30,33)34/h3-4,7-12,20,24,31H,2,5-6,13-18H2,1H3/t20?,24-,28?/m1/s1 |
| InChIKey | KVHMTQKSCDMBMG-KBEAHSEHSA-N |
| XLogP | 3.24 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|