C27H30N2O4S — CID 69443051
2-[4-[(1S,12S,14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]butyl]-1,2-benzothiazol-3-one (PubChem CID 69443051) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is 2-[4-[(1S,12S,14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]butyl]-1,2-benzothiazol-3-one.
| Compound Name | 2-[4-[(1S,12S,14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]butyl]-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 69443051 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-[4-[(1S,12S,14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]butyl]-1,2-benzothiazol-3-one |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](O)C=C[C@@]31CCN(CCCCn1sc3ccccc3c1=O)C2 |
| InChI | InChI=1S/C27H30N2O4S/c1-32-21-9-8-18-17-28(13-4-5-14-29-26(31)20-6-2-3-7-22(20)34-29)15-12-27-11-10-19(30)16-23(27)33-25(21)24(18)27/h2-3,6-11,19,23,30H,4-5,12-17H2,1H3/t19-,23-,27-/m0/s1 |
| InChIKey | NWJZTWVNLAHMOM-UHORWHLBSA-N |
| XLogP | 4.08 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|