C27H30N2O6S — CID 71209929
2-[4-(14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl)butyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 71209929) has the molecular formula C27H30N2O6S and a molecular weight of 510.61 g/mol. Its IUPAC name is 2-[4-(14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl)butyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[4-(14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl)butyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 71209929 |
| Molecular Formula | C27H30N2O6S |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 2-[4-(14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl)butyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | COc1ccc2c3c1OC1CC(O)C=CC31CCN(CCCCN1C(=O)c3ccccc3S1(=O)=O)C2 |
| InChI | InChI=1S/C27H30N2O6S/c1-34-21-9-8-18-17-28(15-12-27-11-10-19(30)16-23(27)35-25(21)24(18)27)13-4-5-14-29-26(31)20-6-2-3-7-22(20)36(29,32)33/h2-3,6-11,19,23,30H,4-5,12-17H2,1H3 |
| InChIKey | NSLKTXHORUYEKW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|