C28H28N2O4 — CID 139970717
2-[(1S,12S,14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]-N-naphthalen-1-ylacetamide (PubChem CID 139970717) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-[(1S,12S,14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(1S,12S,14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 139970717 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 2-[(1S,12S,14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]-N-naphthalen-1-ylacetamide |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](O)C=C[C@@]31CCN(CC(=O)Nc1cccc3ccccc13)C2 |
| InChI | InChI=1S/C28H28N2O4/c1-33-23-10-9-19-16-30(14-13-28-12-11-20(31)15-24(28)34-27(23)26(19)28)17-25(32)29-22-8-4-6-18-5-2-3-7-21(18)22/h2-12,20,24,31H,13-17H2,1H3,(H,29,32)/t20-,24-,28-/m0/s1 |
| InChIKey | ZQGCMWLQZFSRER-IDOVBLGQSA-N |
| XLogP | 4.01 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|