C25H18N2OS — CID 122186251
3-(4-phenoxyphenyl)-7-phenylthieno[3,2-c]pyridin-4-amine (PubChem CID 122186251) has the molecular formula C25H18N2OS and a molecular weight of 394.50 g/mol. Its IUPAC name is 3-(4-phenoxyphenyl)-7-phenylthieno[3,2-c]pyridin-4-amine.
| Compound Name | 3-(4-phenoxyphenyl)-7-phenylthieno[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 122186251 |
| Molecular Formula | C25H18N2OS |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 3-(4-phenoxyphenyl)-7-phenylthieno[3,2-c]pyridin-4-amine |
| SMILES | Nc1ncc(-c2ccccc2)c2scc(-c3ccc(Oc4ccccc4)cc3)c12 |
| InChI | InChI=1S/C25H18N2OS/c26-25-23-22(16-29-24(23)21(15-27-25)17-7-3-1-4-8-17)18-11-13-20(14-12-18)28-19-9-5-2-6-10-19/h1-16H,(H2,26,27) |
| InChIKey | UMDMXVONRZGSHM-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |