C23H22N2OS — CID 122186254
7-butyl-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine (PubChem CID 122186254) has the molecular formula C23H22N2OS and a molecular weight of 374.51 g/mol. Its IUPAC name is 7-butyl-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine.
| Compound Name | 7-butyl-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 122186254 |
| Molecular Formula | C23H22N2OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 7-butyl-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine |
| SMILES | CCCCc1cnc(N)c2c(-c3ccc(Oc4ccccc4)cc3)csc12 |
| InChI | InChI=1S/C23H22N2OS/c1-2-3-7-17-14-25-23(24)21-20(15-27-22(17)21)16-10-12-19(13-11-16)26-18-8-5-4-6-9-18/h4-6,8-15H,2-3,7H2,1H3,(H2,24,25) |
| InChIKey | KJVXUHYJXXXOPH-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |