C23H19N3O6S — CID 122186724
N-hydroxy-4-[[1,1,3-trioxo-6-[(2-phenylacetyl)amino]-1,2-benzothiazol-2-yl]methyl]benzamide (PubChem CID 122186724) has the molecular formula C23H19N3O6S and a molecular weight of 465.49 g/mol. Its IUPAC name is N-hydroxy-4-[[1,1,3-trioxo-6-[(2-phenylacetyl)amino]-1,2-benzothiazol-2-yl]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[1,1,3-trioxo-6-[(2-phenylacetyl)amino]-1,2-benzothiazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 122186724 |
| Molecular Formula | C23H19N3O6S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | N-hydroxy-4-[[1,1,3-trioxo-6-[(2-phenylacetyl)amino]-1,2-benzothiazol-2-yl]methyl]benzamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc2c(c1)S(=O)(=O)N(Cc1ccc(C(=O)NO)cc1)C2=O |
| InChI | InChI=1S/C23H19N3O6S/c27-21(12-15-4-2-1-3-5-15)24-18-10-11-19-20(13-18)33(31,32)26(23(19)29)14-16-6-8-17(9-7-16)22(28)25-30/h1-11,13,30H,12,14H2,(H,24,27)(H,25,28) |
| InChIKey | XMNXGWBKMPGZIN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|