C22H17F3O3Se — CID 122187681
2,2-Dimethyl-3-[3-(trifluoromethyl)phenyl]selanyl-3,4-dihydrobenzo[h]chromene-5,6-dione (PubChem CID 122187681) has the molecular formula C22H17F3O3Se and a molecular weight of 465.30 g/mol. Its IUPAC name is 2,2-dimethyl-3-[3-(trifluoromethyl)phenyl]selanyl-3,4-dihydrobenzo[h]chromene-5,6-dione.
| Compound Name | 2,2-Dimethyl-3-[3-(trifluoromethyl)phenyl]selanyl-3,4-dihydrobenzo[h]chromene-5,6-dione |
|---|---|
| PubChem CID | 122187681 |
| Molecular Formula | C22H17F3O3Se |
| Molecular Weight | 465.30 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | 2,2-dimethyl-3-[3-(trifluoromethyl)phenyl]selanyl-3,4-dihydrobenzo[h]chromene-5,6-dione |
| SMILES | CC1(C(CC2=C(O1)C3=CC=CC=C3C(=O)C2=O)[Se]C4=CC=CC(=C4)C(F)(F)F)C |
| InChI | InChI=1S/C22H17F3O3Se/c1-21(2)17(29-13-7-5-6-12(10-13)22(23,24)25)11-16-19(27)18(26)14-8-3-4-9-15(14)20(16)28-21/h3-10,17H,11H2,1-2H3 |
| InChIKey | ATCYVHURVWBFGU-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | 727 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|