C17H16F3N3O4S — CID 122189266
4-[5-hydroxy-3-(4-methoxyphenyl)-5-(trifluoromethyl)-4H-pyrazol-1-yl]benzenesulfonamide (PubChem CID 122189266) has the molecular formula C17H16F3N3O4S and a molecular weight of 415.39 g/mol. Its IUPAC name is 4-[5-hydroxy-3-(4-methoxyphenyl)-5-(trifluoromethyl)-4H-pyrazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[5-hydroxy-3-(4-methoxyphenyl)-5-(trifluoromethyl)-4H-pyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 122189266 |
| Molecular Formula | C17H16F3N3O4S |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 4-[5-hydroxy-3-(4-methoxyphenyl)-5-(trifluoromethyl)-4H-pyrazol-1-yl]benzenesulfonamide |
| SMILES | COc1ccc(C2=NN(c3ccc(S(N)(=O)=O)cc3)C(O)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C17H16F3N3O4S/c1-27-13-6-2-11(3-7-13)15-10-16(24,17(18,19)20)23(22-15)12-4-8-14(9-5-12)28(21,25)26/h2-9,24H,10H2,1H3,(H2,21,25,26) |
| InChIKey | QIBWWMDCMRAUEX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_5_C(2)', 'substructure': 'N/A'} |
|---|