C15H11ClN2O3 — CID 122189976
4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]benzene-1,2-diol (PubChem CID 122189976) has the molecular formula C15H11ClN2O3 and a molecular weight of 302.72 g/mol. Its IUPAC name is 4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]benzene-1,2-diol.
| Compound Name | 4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 122189976 |
| Molecular Formula | C15H11ClN2O3 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]benzene-1,2-diol |
| SMILES | Oc1ccc(Cc2nc(-c3ccc(Cl)cc3)no2)cc1O |
| InChI | InChI=1S/C15H11ClN2O3/c16-11-4-2-10(3-5-11)15-17-14(21-18-15)8-9-1-6-12(19)13(20)7-9/h1-7,19-20H,8H2 |
| InChIKey | WCHKPUNLFUXURP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|