C14H9Cl2N3O — CID 162730893
5-[(4-chlorophenyl)methyl]-3-(6-chloro-3-pyridinyl)-1,2,4-oxadiazole (PubChem CID 162730893) has the molecular formula C14H9Cl2N3O and a molecular weight of 306.15 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methyl]-3-(6-chloro-3-pyridinyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(4-chlorophenyl)methyl]-3-(6-chloro-3-pyridinyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 162730893 |
| Molecular Formula | C14H9Cl2N3O |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 5-[(4-chlorophenyl)methyl]-3-(6-chloro-3-pyridinyl)-1,2,4-oxadiazole |
| SMILES | Clc1ccc(Cc2nc(-c3ccc(Cl)nc3)no2)cc1 |
| InChI | InChI=1S/C14H9Cl2N3O/c15-11-4-1-9(2-5-11)7-13-18-14(19-20-13)10-3-6-12(16)17-8-10/h1-6,8H,7H2 |
| InChIKey | DZQKDAYNFGQYLI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|