C25H22Cl2N4O2 — CID 122191237
4-(2,3-dichlorophenyl)-7-(4-methylpiperazine-1-carbonyl)-9H-carbazole-1-carboxamide (PubChem CID 122191237) has the molecular formula C25H22Cl2N4O2 and a molecular weight of 481.38 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-7-(4-methylpiperazine-1-carbonyl)-9H-carbazole-1-carboxamide.
| Compound Name | 4-(2,3-dichlorophenyl)-7-(4-methylpiperazine-1-carbonyl)-9H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 122191237 |
| Molecular Formula | C25H22Cl2N4O2 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-7-(4-methylpiperazine-1-carbonyl)-9H-carbazole-1-carboxamide |
| SMILES | CN1CCN(C(=O)c2ccc3c(c2)[nH]c2c(C(N)=O)ccc(-c4cccc(Cl)c4Cl)c23)CC1 |
| InChI | InChI=1S/C25H22Cl2N4O2/c1-30-9-11-31(12-10-30)25(33)14-5-6-17-20(13-14)29-23-18(24(28)32)8-7-15(21(17)23)16-3-2-4-19(26)22(16)27/h2-8,13,29H,9-12H2,1H3,(H2,28,32) |
| InChIKey | SNFKMGRMVKNSJZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |