C15H12N6O4Se — CID 122191484
5-benzylselanyl-1-[(3,5-dinitrophenyl)methyl]tetrazole (PubChem CID 122191484) has the molecular formula C15H12N6O4Se and a molecular weight of 419.26 g/mol. Its IUPAC name is 5-benzylselanyl-1-[(3,5-dinitrophenyl)methyl]tetrazole.
| Compound Name | 5-benzylselanyl-1-[(3,5-dinitrophenyl)methyl]tetrazole |
|---|---|
| PubChem CID | 122191484 |
| Molecular Formula | C15H12N6O4Se |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | 5-benzylselanyl-1-[(3,5-dinitrophenyl)methyl]tetrazole |
| SMILES | O=[N+]([O-])c1cc(Cn2nnnc2[Se]Cc2ccccc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12N6O4Se/c22-20(23)13-6-12(7-14(8-13)21(24)25)9-19-15(16-17-18-19)26-10-11-4-2-1-3-5-11/h1-8H,9-10H2 |
| InChIKey | IJRGRNXDIXUSFX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|