C16H14ClN3O3S — CID 122192449
ethyl 6-[4-[(2-chloroacetyl)amino]phenyl]imidazo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 122192449) has the molecular formula C16H14ClN3O3S and a molecular weight of 363.83 g/mol. Its IUPAC name is ethyl 6-[4-[(2-chloroacetyl)amino]phenyl]imidazo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | ethyl 6-[4-[(2-chloroacetyl)amino]phenyl]imidazo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 122192449 |
| Molecular Formula | C16H14ClN3O3S |
| Molecular Weight | 363.83 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | ethyl 6-[4-[(2-chloroacetyl)amino]phenyl]imidazo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | CCOC(=O)c1csc2nc(-c3ccc(NC(=O)CCl)cc3)cn12 |
| InChI | InChI=1S/C16H14ClN3O3S/c1-2-23-15(22)13-9-24-16-19-12(8-20(13)16)10-3-5-11(6-4-10)18-14(21)7-17/h3-6,8-9H,2,7H2,1H3,(H,18,21) |
| InChIKey | NXFXZFJVJBZDNR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|