C16H15N3O3S — CID 170609686
ethyl 6-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 170609686) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is ethyl 6-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | ethyl 6-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 170609686 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | ethyl 6-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | CCOC(=O)c1csc2nc(-c3ccc(NC(C)=O)cc3)cn12 |
| InChI | InChI=1S/C16H15N3O3S/c1-3-22-15(21)14-9-23-16-18-13(8-19(14)16)11-4-6-12(7-5-11)17-10(2)20/h4-9H,3H2,1-2H3,(H,17,20) |
| InChIKey | PTHXJADOYKERJT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |