C9H13FN2O — CID 122192591
2-fluoro-1-[1-(2-methylpropyl)pyrazol-4-yl]ethanone (PubChem CID 122192591) has the molecular formula C9H13FN2O and a molecular weight of 184.21 g/mol. Its IUPAC name is 2-fluoro-1-[1-(2-methylpropyl)pyrazol-4-yl]ethanone.
| Compound Name | 2-fluoro-1-[1-(2-methylpropyl)pyrazol-4-yl]ethanone |
|---|---|
| PubChem CID | 122192591 |
| Molecular Formula | C9H13FN2O |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-fluoro-1-[1-(2-methylpropyl)pyrazol-4-yl]ethanone |
| SMILES | CC(C)Cn1cc(C(=O)CF)cn1 |
| InChI | InChI=1S/C9H13FN2O/c1-7(2)5-12-6-8(4-11-12)9(13)3-10/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | ICORYXMUVRLABT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |