C8H14N2O — CID 62729998
[1-(2-methylpropyl)pyrazol-4-yl]methanol (PubChem CID 62729998) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is [1-(2-methylpropyl)pyrazol-4-yl]methanol.
| Compound Name | [1-(2-methylpropyl)pyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 62729998 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | [1-(2-methylpropyl)pyrazol-4-yl]methanol |
| SMILES | CC(C)Cn1cc(CO)cn1 |
| InChI | InChI=1S/C8H14N2O/c1-7(2)4-10-5-8(6-11)3-9-10/h3,5,7,11H,4,6H2,1-2H3 |
| InChIKey | ZRRRTBZRVPFFJP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |