C12H24ClN3O — CID 126966892
3-methoxy-N-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]propan-1-amine;hydrochloride (PubChem CID 126966892) has the molecular formula C12H24ClN3O and a molecular weight of 261.80 g/mol. Its IUPAC name is 3-methoxy-N-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]propan-1-amine;hydrochloride.
| Compound Name | 3-methoxy-N-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 126966892 |
| Molecular Formula | C12H24ClN3O |
| Molecular Weight | 261.80 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 3-methoxy-N-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]propan-1-amine;hydrochloride |
| SMILES | COCCCNCc1cnn(CC(C)C)c1.Cl |
| InChI | InChI=1S/C12H23N3O.ClH/c1-11(2)9-15-10-12(8-14-15)7-13-5-4-6-16-3;/h8,10-11,13H,4-7,9H2,1-3H3;1H |
| InChIKey | GKELDKNEEAPGGB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.80 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|