C13H24ClF2N3 — CID 126967924
N-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]heptan-1-amine;hydrochloride (PubChem CID 126967924) has the molecular formula C13H24ClF2N3 and a molecular weight of 295.80 g/mol. Its IUPAC name is N-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]heptan-1-amine;hydrochloride.
| Compound Name | N-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]heptan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 126967924 |
| Molecular Formula | C13H24ClF2N3 |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]heptan-1-amine;hydrochloride |
| SMILES | CCCCCCCNCc1cnn(CC(F)F)c1.Cl |
| InChI | InChI=1S/C13H23F2N3.ClH/c1-2-3-4-5-6-7-16-8-12-9-17-18(10-12)11-13(14)15;/h9-10,13,16H,2-8,11H2,1H3;1H |
| InChIKey | TYFIIUGMESJIPG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|